cas: 117678-38-3 — see every product listed under this CAS number, including other names
Levofloxacin N-Oxide (CAS 117678-38-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 1mg, 2mg, 5mg, 10mg, 50mg, 100mg, 200mg. Offered by: Mikromol, TargetMol, Biosynth, Chemat.
| brand | Mikromol |
|---|---|
| catalog number | MM0846.03-0025 |
| cas | 117678-38-3 |
| size | 25mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Mikromol | 25mg | price on request | |
| TargetMol | 1mg | 379.44 Pln | |
| TargetMol | 2mg | 445.96 Pln | |
| TargetMol | 5mg | 624.84 Pln | |
| TargetMol | 10mg | 870.80 Pln | |
| TargetMol | 25mg | 1322.47 Pln | |
| TargetMol | 50mg | 1760.73 Pln | |
| TargetMol | 100mg | 2385.13 Pln | |
| TargetMol | 200mg | 3274.50 Pln | |
| Biosynth | 2mg | price on request | |
| Biosynth | 5mg | price on request | |
| Biosynth | 10mg | price on request | |
| Biosynth | 50mg | price on request | |
| Biosynth | 25mg | price on request | |
| Chemat | 10mg | 1504.40 Pln | |
| Chemat | 25mg | 2656.40 Pln | |
| Chemat | 50mg | 4470.80 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S)-7-fluoro-2-methyl-6-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid (CAS 117678-38-3) is a chemical compound with the molecular formula C18H20FN3O5 and a molecular weight of 377.4 g/mol. IUPAC name: (2S)-7-fluoro-2-methyl-6-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid. InChIKey: MVLAUMUQGRQERL-JTQLQIEISA-N.
| Molecular formula | C18H20FN3O5 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (2S)-7-fluoro-2-methyl-6-(4-methyl-4-oxidopiperazin-4-ium-1-yl)-10-oxo-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid |
| InChIKey | MVLAUMUQGRQERL-JTQLQIEISA-N |
| SMILES | C[C@H]1COC2=C3N1C=C(C(=O)C3=CC(=C2N4CC[N+](CC4)(C)[O-])F)C(=O)O |
Computed by PubChem (NCBI)