CAS 2883539-04-4 is the registry number for tert-Butyl (2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxoisoindolin-5-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]carbamate (CAS 2883539-04-4) is a chemical compound with the molecular formula C18H20FN3O5 and a molecular weight of 377.4 g/mol. IUPAC name: tert-butyl N-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]carbamate. InChIKey: PMJCNDVKSNAVHP-UHFFFAOYSA-N.
| Molecular formula | C18H20FN3O5 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | tert-butyl N-[2-(2,6-dioxopiperidin-3-yl)-4-fluoro-1-oxo-3H-isoindol-5-yl]carbamate |
| InChIKey | PMJCNDVKSNAVHP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C2=C(C=C1)C(=O)N(C2)C3CCC(=O)NC3=O)F |
Computed by PubChem (NCBI)