cas: 108825-65-6 — see every product listed under this CAS number, including other names
Lin28-let-7 antagonist 1 95% (CAS 108825-65-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A428442-1mg |
| cas | 108825-65-6 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 292.50 Pln | |
| Ambeed | 5mg | 548.38 Pln | |
| Ambeed | 10mg | 782.00 Pln | |
| Ambeed | 25mg | 1377.19 Pln | |
| Ambeed | 50mg | 1866.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A428442 |
N-methyl-N-[3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]acetamide (CAS 108825-65-6) is a chemical compound with the molecular formula C15H15N5O and a molecular weight of 281.31 g/mol. IUPAC name: N-methyl-N-[3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]acetamide. InChIKey: WPAQLESUVYGUJZ-UHFFFAOYSA-N.
| Molecular formula | C15H15N5O |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | N-methyl-N-[3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]acetamide |
| InChIKey | WPAQLESUVYGUJZ-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1N=C(C=C2)C3=CC(=CC=C3)N(C)C(=O)C |
Computed by PubChem (NCBI)