CAS 108825-65-6 appears in our catalog under these names: N-Methyl-n-[3-(3-methyl[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]acetamide, 95%, Lin28 1632, Lin281632, Lin28 1632, Lin28-let-7 antagonist 1 95%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 10mg, 50mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 1mg, 500mg.
N-methyl-N-[3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]acetamide (CAS 108825-65-6) is a chemical compound with the molecular formula C15H15N5O and a molecular weight of 281.31 g/mol. IUPAC name: N-methyl-N-[3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]acetamide. InChIKey: WPAQLESUVYGUJZ-UHFFFAOYSA-N.
| Molecular formula | C15H15N5O |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | N-methyl-N-[3-(3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)phenyl]acetamide |
| InChIKey | WPAQLESUVYGUJZ-UHFFFAOYSA-N |
| SMILES | CC1=NN=C2N1N=C(C=C2)C3=CC(=CC=C3)N(C)C(=O)C |
Computed by PubChem (NCBI)