cas: 25387-93-3 — see every product listed under this CAS number, including other names
Liq 98% (CAS 25387-93-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A411195-10g |
| cas | 25387-93-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 481.62 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 5g | 281.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A411195 |
Lithium quinolin-8-olate (CAS 25387-93-3) is a chemical compound with the molecular formula C9H6LiNO and a molecular weight of 151.1 g/mol. IUPAC name: lithium quinolin-8-olate. InChIKey: FQHFBFXXYOQXMN-UHFFFAOYSA-M.
| Molecular formula | C9H6LiNO |
|---|---|
| Molecular weight | 151.1 g/mol |
| IUPAC name | lithium quinolin-8-olate |
| InChIKey | FQHFBFXXYOQXMN-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC2=C(C(=C1)[O-])N=CC=C2 |
Computed by PubChem (NCBI)