CAS 409071-16-5 appears in our catalog under these names: Lithium difluoro(oxalato)borate, Lithium difluoro(oxalato)borate, Lithium difluoro(oxalato)borate, 95%. Offered by: GLPBio, Biosynth, TCI, Sigma-Aldrich, Fluorochem. Available pack sizes: 100g, 500g, 250g, 1g, 5g, 25G, 50g, 1kg.
Lithium 2,2-difluoro-1,3-dioxa-2-boranuidacyclopentane-4,5-dione (CAS 409071-16-5) is a chemical compound with the molecular formula C2BF2LiO4 and a molecular weight of 143.8 g/mol. IUPAC name: lithium 2,2-difluoro-1,3-dioxa-2-boranuidacyclopentane-4,5-dione. InChIKey: MEDDCIKGDMDORY-UHFFFAOYSA-N.
| Molecular formula | C2BF2LiO4 |
|---|---|
| Molecular weight | 143.8 g/mol |
| IUPAC name | lithium 2,2-difluoro-1,3-dioxa-2-boranuidacyclopentane-4,5-dione |
| InChIKey | MEDDCIKGDMDORY-UHFFFAOYSA-N |
| SMILES | [Li+].[B-]1(OC(=O)C(=O)O1)(F)F |
Computed by PubChem (NCBI)