cas: 1256364-38-1 — see every product listed under this CAS number, including other names
Lithium triisopropoxy(5-methoxypyridin-2-yl)borate 95% (CAS 1256364-38-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A694229-100mg |
| cas | 1256364-38-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 342.56 Pln | |
| Ambeed | 250mg | 442.69 Pln | |
| Ambeed | 1g | 909.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A694229 |
Lithium (5-methoxy-2-pyridinyl)-tri(propan-2-yloxy)boranuide (CAS 1256364-38-1) is a chemical compound with the molecular formula C15H27BLiNO4 and a molecular weight of 303.2 g/mol. IUPAC name: lithium (5-methoxy-2-pyridinyl)-tri(propan-2-yloxy)boranuide. InChIKey: PQLHSQKCIJQZOA-UHFFFAOYSA-N.
| Molecular formula | C15H27BLiNO4 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | lithium (5-methoxy-2-pyridinyl)-tri(propan-2-yloxy)boranuide |
| InChIKey | PQLHSQKCIJQZOA-UHFFFAOYSA-N |
| SMILES | [Li+].[B-](C1=NC=C(C=C1)OC)(OC(C)C)(OC(C)C)OC(C)C |
Computed by PubChem (NCBI)