CAS 1256364-38-1 appears in our catalog under these names: Lithium triisopropyl 2-(5-methoxypyridyl)borate, 95%, Lithium triisopropoxy(5-methoxypyridin-2-yl)borate 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg.
Lithium (5-methoxy-2-pyridinyl)-tri(propan-2-yloxy)boranuide (CAS 1256364-38-1) is a chemical compound with the molecular formula C15H27BLiNO4 and a molecular weight of 303.2 g/mol. IUPAC name: lithium (5-methoxy-2-pyridinyl)-tri(propan-2-yloxy)boranuide. InChIKey: PQLHSQKCIJQZOA-UHFFFAOYSA-N.
| Molecular formula | C15H27BLiNO4 |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | lithium (5-methoxy-2-pyridinyl)-tri(propan-2-yloxy)boranuide |
| InChIKey | PQLHSQKCIJQZOA-UHFFFAOYSA-N |
| SMILES | [Li+].[B-](C1=NC=C(C=C1)OC)(OC(C)C)(OC(C)C)OC(C)C |
Computed by PubChem (NCBI)