CAS 135558-11-1 appears in our catalog under these names: Lobaplatin, Lobaplatin/ 98%, Lobaplatin 98+%, Lobaplatin, 98+%, 98+%, Lobaplatin, 98.0%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml water), 50mg, 25mg, 100mg, 250mg.
[(1R,2R)-2-(aminomethyl)cyclobutyl]methanamine;(2S)-2-oxidopropanoate;platinum(2+) (CAS 135558-11-1) is a chemical compound with the molecular formula C9H18N2O3Pt and a molecular weight of 397.33 g/mol. IUPAC name: [(1R,2R)-2-(aminomethyl)cyclobutyl]methanamine;(2S)-2-oxidopropanoate;platinum(2+). InChIKey: RLXPIABKJFUYFG-DOYDWZMXSA-M.
| Molecular formula | C9H18N2O3Pt |
|---|---|
| Molecular weight | 397.33 g/mol |
| IUPAC name | [(1R,2R)-2-(aminomethyl)cyclobutyl]methanamine;(2S)-2-oxidopropanoate;platinum(2+) |
| InChIKey | RLXPIABKJFUYFG-DOYDWZMXSA-M |
| SMILES | C[C@@H](C(=O)[O-])[O-].C1C[C@H]([C@@H]1CN)CN.[Pt+2] |
Computed by PubChem (NCBI)