cas: 63610-09-3 — see every product listed under this CAS number, including other names
Lodoxamide tromethamine, 95% (CAS 63610-09-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g, 5g, 1mg, 5mg, 10mg, 25mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A202923-50mg |
| cas | 63610-09-3 |
| size | 50mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 253.56 Pln | |
| Ambeed | 250mg | 676.31 Pln | |
| Ambeed | 1g | 1738.75 Pln | |
| Ambeed | 5g | 5148.56 Pln | |
| Ambeed | 1mg | 153.44 Pln | |
| Ambeed | 5mg | 175.69 Pln | |
| Ambeed | 10mg | 197.94 Pln | |
| Ambeed | 25mg | 225.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);2-[2-chloro-5-cyano-3-(oxaloamino)anilino]-2-oxoacetic acid (CAS 63610-09-3) is a chemical compound with the molecular formula C19H28ClN5O12 and a molecular weight of 553.9 g/mol. IUPAC name: bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);2-[2-chloro-5-cyano-3-(oxaloamino)anilino]-2-oxoacetic acid. InChIKey: JJOFNSLZHKIJEV-UHFFFAOYSA-N.
| Molecular formula | C19H28ClN5O12 |
|---|---|
| Molecular weight | 553.9 g/mol |
| IUPAC name | bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);2-[2-chloro-5-cyano-3-(oxaloamino)anilino]-2-oxoacetic acid |
| InChIKey | JJOFNSLZHKIJEV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1NC(=O)C(=O)O)Cl)NC(=O)C(=O)O)C#N.C(C(CO)(CO)N)O.C(C(CO)(CO)N)O |
Computed by PubChem (NCBI)