CAS 63610-09-3 appears in our catalog under these names: Lodoxamide Tromethamine, Lodoxamide tromethamine/ 99.58% (existing batch purity), Lodoxamide tromethamine 95%, Lodoxamide (tromethamine), 99.83%, Lodoxamide (tromethamine) (Standard). Offered by: Chemat Brand, TargetMol, Ambeed, MedChemExpress, Chemat. Available pack sizes: on request, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
Bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);2-[2-chloro-5-cyano-3-(oxaloamino)anilino]-2-oxoacetic acid (CAS 63610-09-3) is a chemical compound with the molecular formula C19H28ClN5O12 and a molecular weight of 553.9 g/mol. IUPAC name: bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);2-[2-chloro-5-cyano-3-(oxaloamino)anilino]-2-oxoacetic acid. InChIKey: JJOFNSLZHKIJEV-UHFFFAOYSA-N.
| Molecular formula | C19H28ClN5O12 |
|---|---|
| Molecular weight | 553.9 g/mol |
| IUPAC name | bis(2-amino-2-(hydroxymethyl)propane-1,3-diol);2-[2-chloro-5-cyano-3-(oxaloamino)anilino]-2-oxoacetic acid |
| InChIKey | JJOFNSLZHKIJEV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1NC(=O)C(=O)O)Cl)NC(=O)C(=O)O)C#N.C(C(CO)(CO)N)O.C(C(CO)(CO)N)O |
Computed by PubChem (NCBI)