CAS 91431-42-4 appears in our catalog under these names: Lonapalene/ 98.82% (existing batch purity), Lonapalene (RS4317), Lonapalene, Lonapalene, 99.45%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 20mg, 100mg, 2mg.
(4-acetyloxy-6-chloro-2,3-dimethoxynaphthalen-1-yl) acetate (CAS 91431-42-4) is a chemical compound with the molecular formula C16H15ClO6 and a molecular weight of 338.74 g/mol. IUPAC name: (4-acetyloxy-6-chloro-2,3-dimethoxynaphthalen-1-yl) acetate. InChIKey: IFWMVQUGSGWCRP-UHFFFAOYSA-N.
| Molecular formula | C16H15ClO6 |
|---|---|
| Molecular weight | 338.74 g/mol |
| IUPAC name | (4-acetyloxy-6-chloro-2,3-dimethoxynaphthalen-1-yl) acetate |
| InChIKey | IFWMVQUGSGWCRP-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C(=C(C2=C1C=CC(=C2)Cl)OC(=O)C)OC)OC |
Computed by PubChem (NCBI)