CAS 469-54-5 appears in our catalog under these names: Griseofulvic Acid, >95% (HPLC), Griseofulvic Acid, Griseofulvic acid. Offered by: TRC, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 250mg, 25mg, 1mg, 250μg, 50mg, 100mg, 500mg, 250 μg.
(2S,5'R)-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohexane]-1',3,3'-trione (CAS 469-54-5) is a chemical compound with the molecular formula C16H15ClO6 and a molecular weight of 338.74 g/mol. IUPAC name: (2S,5'R)-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohexane]-1',3,3'-trione. InChIKey: YIQRSAKVWZVLDN-QZTNRIJFSA-N.
| Molecular formula | C16H15ClO6 |
|---|---|
| Molecular weight | 338.74 g/mol |
| IUPAC name | (2S,5'R)-7-chloro-4,6-dimethoxy-5'-methylspiro[1-benzofuran-2,4'-cyclohexane]-1',3,3'-trione |
| InChIKey | YIQRSAKVWZVLDN-QZTNRIJFSA-N |
| SMILES | C[C@@H]1CC(=O)CC(=O)[C@]12C(=O)C3=C(O2)C(=C(C=C3OC)OC)Cl |
Computed by PubChem (NCBI)