CAS 150869-74-2 appears in our catalog under these names: Ly-295501/ 98.97% (existing batch purity), Ly-295501. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
1-(3,4-dichlorophenyl)-3-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)urea (CAS 150869-74-2) is a chemical compound with the molecular formula C15H12Cl2N2O4S and a molecular weight of 387.2 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-3-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)urea. InChIKey: VAMFSFIPDOODFH-UHFFFAOYSA-N.
| Molecular formula | C15H12Cl2N2O4S |
|---|---|
| Molecular weight | 387.2 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-3-(2,3-dihydro-1-benzofuran-5-ylsulfonyl)urea |
| InChIKey | VAMFSFIPDOODFH-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)S(=O)(=O)NC(=O)NC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)