CAS 883976-12-3 appears in our catalog under these names: M8-B Hydrochloride/ 99.71% (existing batch purity), M8–B (hydrochloride), M8-B hydrochloride, N-(2-Aminoethyl)-N-(4-(benzyloxy)-3-methoxybenzyl)thiophene-2-carboxamide hydrochloride, 98%, 98%, M8-B, 99.74%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
N-(2-aminoethyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]thiophene-2-carboxamide;hydrochloride (CAS 883976-12-3) is a chemical compound with the molecular formula C22H25ClN2O3S and a molecular weight of 433.0 g/mol. IUPAC name: N-(2-aminoethyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]thiophene-2-carboxamide;hydrochloride. InChIKey: FMQJBHACRTZLME-UHFFFAOYSA-N.
| Molecular formula | C22H25ClN2O3S |
|---|---|
| Molecular weight | 433.0 g/mol |
| IUPAC name | N-(2-aminoethyl)-N-[(3-methoxy-4-phenylmethoxyphenyl)methyl]thiophene-2-carboxamide;hydrochloride |
| InChIKey | FMQJBHACRTZLME-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CN(CCN)C(=O)C2=CC=CS2)OCC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)