CAS 146724-86-9 appears in our catalog under these names: MAHMA NONOate/ min. 98%, MAHMA NONOate, 6-(2-Hydroxy-1-methyl-2-nitrosohydrazinyl)-N-methyl-1-hexanamine, MAHMA NONOate. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 10mg, 100mg, 25mg, 50mg, 10 mg, 50 mg, 5 mg.
(Z)-hydroxyimino-[methyl-[6-(methylamino)hexyl]amino]-oxidoazanium (CAS 146724-86-9) is a chemical compound with the molecular formula C8H20N4O2 and a molecular weight of 204.27 g/mol. IUPAC name: (Z)-hydroxyimino-[methyl-[6-(methylamino)hexyl]amino]-oxidoazanium. InChIKey: KQHAZGURWZYZJG-BENRWUELSA-N.
| Molecular formula | C8H20N4O2 |
|---|---|
| Molecular weight | 204.27 g/mol |
| IUPAC name | (Z)-hydroxyimino-[methyl-[6-(methylamino)hexyl]amino]-oxidoazanium |
| InChIKey | KQHAZGURWZYZJG-BENRWUELSA-N |
| SMILES | CNCCCCCCN(C)/[N+](=N/O)/[O-] |
Computed by PubChem (NCBI)