CAS 1047953-91-2 appears in our catalog under these names: MI-2 [MALT1 Inhibitor], MALT1 inhibitor MI-2, 99.73%, MALT1 inhibitor MI-2/ 99.87% (existing batch purity), 2-Chloro-N-(4-(5-(3,4-dichlorophenyl)-3-(2-methoxyethoxy)-1H-1,2,4-triazol-1-yl)phenyl)acetamide, 99% (HPLC), 99% (HPLC). Offered by: Chemat, MedChemExpress, TargetMol. Available pack sizes: 25mg, 5mg, 100 mg, 10mM/1mL, 50 mg, 10 mg, 5 mg, 1mg.
2-chloro-N-[4-[5-(3,4-dichlorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]acetamide (CAS 1047953-91-2) is a chemical compound with the molecular formula C19H17Cl3N4O3 and a molecular weight of 455.7 g/mol. IUPAC name: 2-chloro-N-[4-[5-(3,4-dichlorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]acetamide. InChIKey: TWJGQZBSEMDPQP-UHFFFAOYSA-N.
| Molecular formula | C19H17Cl3N4O3 |
|---|---|
| Molecular weight | 455.7 g/mol |
| IUPAC name | 2-chloro-N-[4-[5-(3,4-dichlorophenyl)-3-(2-methoxyethoxy)-1,2,4-triazol-1-yl]phenyl]acetamide |
| InChIKey | TWJGQZBSEMDPQP-UHFFFAOYSA-N |
| SMILES | COCCOC1=NN(C(=N1)C2=CC(=C(C=C2)Cl)Cl)C3=CC=C(C=C3)NC(=O)CCl |
Computed by PubChem (NCBI)