CAS 849909-77-9 appears in our catalog under these names: MAO-B-IN-5/ 97.16% (existing batch purity), MAO-B-IN-5. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
(2S)-1-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]pyrrolidine-2-carboxamide (CAS 849909-77-9) is a chemical compound with the molecular formula C19H21FN2O2 and a molecular weight of 328.4 g/mol. IUPAC name: (2S)-1-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]pyrrolidine-2-carboxamide. InChIKey: FVANEFQOAUJITQ-SFHVURJKSA-N.
| Molecular formula | C19H21FN2O2 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | (2S)-1-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]pyrrolidine-2-carboxamide |
| InChIKey | FVANEFQOAUJITQ-SFHVURJKSA-N |
| SMILES | C1C[C@H](N(C1)CC2=CC=C(C=C2)OCC3=CC(=CC=C3)F)C(=O)N |
Computed by PubChem (NCBI)