cas: 511-26-2 — see every product listed under this CAS number, including other names
MAP4343 (CAS 511-26-2) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 200mg. Offered by: GLPBio, Biosynth, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC61400-10 |
| cas | 511-26-2 |
| size | 10mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 1154.02 Pln | |
| GLPBio | 100mg | 4318.04 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 891.91 Pln | |
| GLPBio | 25mg | 1930.98 Pln | |
| GLPBio | 5mg | 849.79 Pln | |
| GLPBio | 50mg | 2885.80 Pln | |
| Biosynth | 100mg | price on request | |
| Biosynth | 50mg | price on request | |
| Chemat | 5mg | 395.60 Pln | |
| Chemat | 10mg | 626.00 Pln | |
| Chemat | 25mg | 1245.20 Pln | |
| Chemat | 50mg | 1850.00 Pln | |
| Chemat | 100mg | 2608.40 Pln | |
| Chemat | 1mg | 198.80 Pln | |
| Chemat | 200mg | 3477.20 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1-[(3S,8S,9S,10R,13S,14S,17S)-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone (CAS 511-26-2) is a chemical compound with the molecular formula C22H34O2 and a molecular weight of 330.5 g/mol. IUPAC name: 1-[(3S,8S,9S,10R,13S,14S,17S)-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone. InChIKey: ZVGQOQHAMHMMNE-BIBIXIOVSA-N.
| Molecular formula | C22H34O2 |
|---|---|
| Molecular weight | 330.5 g/mol |
| IUPAC name | 1-[(3S,8S,9S,10R,13S,14S,17S)-3-methoxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone |
| InChIKey | ZVGQOQHAMHMMNE-BIBIXIOVSA-N |
| SMILES | CC(=O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC=C4[C@@]3(CC[C@@H](C4)OC)C)C |
Computed by PubChem (NCBI)