Products 1185247-85-1
CAS 1185247-85-1 appears in our catalog under these names: Eicosapentaenoic Acid Impurity 1-d5, Eicosapentaenoic Acid-d5 Ethyl Ester. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
Ethyl 19,19,20,20,20-pentadeuterioicosa-5,8,11,14,17-pentaenoate (CAS 1185247-85-1) is a chemical compound with the molecular formula C22H34O2 and a molecular weight of 335.5 g/mol. IUPAC name: ethyl 19,19,20,20,20-pentadeuterioicosa-5,8,11,14,17-pentaenoate. InChIKey: SSQPWTVBQMWLSZ-WNWXXORZSA-N.
| Molecular formula | C22H34O2 |
|---|---|
| Molecular weight | 335.5 g/mol |
| IUPAC name | ethyl 19,19,20,20,20-pentadeuterioicosa-5,8,11,14,17-pentaenoate |
| InChIKey | SSQPWTVBQMWLSZ-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C=CCC=CCC=CCC=CCC=CCCCC(=O)OCC |
Computed by PubChem (NCBI)