Products 13299-99-5
CAS 13299-99-5 appears in our catalog under these names: MAT2A inhibitor 2 99%, MAT2A inhibitor 2, 6-(3-Methoxyphenyl)-4-methyl-2-(2-morpholinoethyl)pyridazin-3(2H)-one hydrochloride, 99%, 99%, MAT2A inhibitor 2/ 99.63% (existing batch purity), MAT2A inhibitor 2, 99.71%. Offered by: Ambeed, GLPBio, Chemat, TargetMol, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 25mg, 500mg.
6-(3-methoxyphenyl)-4-methyl-2-(2-morpholin-4-ylethyl)pyridazin-3-one;hydrochloride (CAS 13299-99-5) is a chemical compound with the molecular formula C18H24ClN3O3 and a molecular weight of 365.9 g/mol. IUPAC name: 6-(3-methoxyphenyl)-4-methyl-2-(2-morpholin-4-ylethyl)pyridazin-3-one;hydrochloride. InChIKey: REOUTEBTFSILJY-UHFFFAOYSA-N.
| Molecular formula | C18H24ClN3O3 |
|---|---|
| Molecular weight | 365.9 g/mol |
| IUPAC name | 6-(3-methoxyphenyl)-4-methyl-2-(2-morpholin-4-ylethyl)pyridazin-3-one;hydrochloride |
| InChIKey | REOUTEBTFSILJY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NN(C1=O)CCN2CCOCC2)C3=CC(=CC=C3)OC.Cl |
Computed by PubChem (NCBI)