CAS 2439277-80-0 appears in our catalog under these names: MAT2A-IN-9/ 98.53% (existing batch purity), MAT2A–IN–9, MAT2A-IN-9 98%. Offered by: TargetMol, GLPBio, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
4-amino-1-(2-chlorophenyl)-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-2-one (CAS 2439277-80-0) is a chemical compound with the molecular formula C14H8ClF3N4O and a molecular weight of 340.69 g/mol. IUPAC name: 4-amino-1-(2-chlorophenyl)-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-2-one. InChIKey: BVNKURJMNQNVAO-UHFFFAOYSA-N.
| Molecular formula | C14H8ClF3N4O |
|---|---|
| Molecular weight | 340.69 g/mol |
| IUPAC name | 4-amino-1-(2-chlorophenyl)-7-(trifluoromethyl)pyrido[2,3-d]pyrimidin-2-one |
| InChIKey | BVNKURJMNQNVAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C3=C(C=CC(=N3)C(F)(F)F)C(=NC2=O)N)Cl |
Computed by PubChem (NCBI)