cas: 57103-68-1 — see every product listed under this CAS number, including other names
MAYTANSINOL, 98%, 98% (CAS 57103-68-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11465O-1mg |
| cas | 57103-68-1 |
| size | 1mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 222.80 Pln | |
| Chemat | 5mg | 467.60 Pln | |
| Chemat | 10mg | 549.20 Pln | |
| Chemat | 25mg | 621.20 Pln | |
| Chemat | 50mg | 1014.80 Pln | |
| Chemat | 100mg | 1677.20 Pln | |
| Chemat | 250mg | 2968.40 Pln | |
| Chemat | 1g | 7648.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-chloro-6,21-dihydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione (CAS 57103-68-1) is a chemical compound with the molecular formula C28H37ClN2O8 and a molecular weight of 565.1 g/mol. IUPAC name: (1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-chloro-6,21-dihydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione. InChIKey: QWPXBEHQFHACTK-RZKXNLMUSA-N.
| Molecular formula | C28H37ClN2O8 |
|---|---|
| Molecular weight | 565.1 g/mol |
| IUPAC name | (1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-chloro-6,21-dihydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
| InChIKey | QWPXBEHQFHACTK-RZKXNLMUSA-N |
| SMILES | C[C@@H]1[C@@H]2C[C@]([C@@H](/C=C/C=C(/CC3=CC(=C(C(=C3)OC)Cl)N(C(=O)C[C@@H]([C@]4([C@H]1O4)C)O)C)\C)OC)(NC(=O)O2)O |
Computed by PubChem (NCBI)