cas: 57103-68-1 — see every product listed under this CAS number, including other names
Maytansinol 98% (CAS 57103-68-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A880207-1mg |
| cas | 57103-68-1 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 286.94 Pln | |
| Ambeed | 5mg | 342.56 Pln | |
| Ambeed | 10mg | 481.62 Pln | |
| Ambeed | 25mg | 932.19 Pln | |
| Ambeed | 50mg | 1460.62 Pln | |
| Ambeed | 100mg | 2150.38 Pln | |
| Ambeed | 250mg | 3785.75 Pln | |
| Ambeed | 1g | 9281.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A880207 |
(1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-chloro-6,21-dihydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione (CAS 57103-68-1) is a chemical compound with the molecular formula C28H37ClN2O8 and a molecular weight of 565.1 g/mol. IUPAC name: (1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-chloro-6,21-dihydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione. InChIKey: QWPXBEHQFHACTK-RZKXNLMUSA-N.
| Molecular formula | C28H37ClN2O8 |
|---|---|
| Molecular weight | 565.1 g/mol |
| IUPAC name | (1S,2R,3S,5S,6S,16E,18E,20R,21S)-11-chloro-6,21-dihydroxy-12,20-dimethoxy-2,5,9,16-tetramethyl-4,24-dioxa-9,22-diazatetracyclo[19.3.1.110,14.03,5]hexacosa-10,12,14(26),16,18-pentaene-8,23-dione |
| InChIKey | QWPXBEHQFHACTK-RZKXNLMUSA-N |
| SMILES | C[C@@H]1[C@@H]2C[C@]([C@@H](/C=C/C=C(/CC3=CC(=C(C(=C3)OC)Cl)N(C(=O)C[C@@H]([C@]4([C@H]1O4)C)O)C)\C)OC)(NC(=O)O2)O |
Computed by PubChem (NCBI)