Products 882755-95-5
CAS 882755-95-5 appears in our catalog under these names: FBPase-IN-5, 99.31%, MB-07729/ 99.14% (existing batch purity), MB-07729. Offered by: MedChemExpress, TargetMol, Chemat. Available pack sizes: 5 mg, 10 mg, 1 mg, 1mg, 5mg, 10mg, 25mg, 50mg.
[5-[2-amino-5-(2,2-dimethylpropanoyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid (CAS 882755-95-5) is a chemical compound with the molecular formula C12H15N2O5PS and a molecular weight of 330.30 g/mol. IUPAC name: [5-[2-amino-5-(2,2-dimethylpropanoyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid. InChIKey: OQFMQCXGUUIUAO-UHFFFAOYSA-N.
| Molecular formula | C12H15N2O5PS |
|---|---|
| Molecular weight | 330.30 g/mol |
| IUPAC name | [5-[2-amino-5-(2,2-dimethylpropanoyl)-1,3-thiazol-4-yl]furan-2-yl]phosphonic acid |
| InChIKey | OQFMQCXGUUIUAO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=C(N=C(S1)N)C2=CC=C(O2)P(=O)(O)O |
Computed by PubChem (NCBI)