CAS 2286411-30-9 appears in our catalog under these names: MBX-4132/ 97.63% (existing batch purity), MBX–4132, MBX-4132, MBX-4132 98%, N-(5-(4-Fluorophenyl)-1,3,4-oxadiazol-2-yl)-3,4-dihydroisoquinoline-2(1H)-carboxamide. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10mM/1mL.
N-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide (CAS 2286411-30-9) is a chemical compound with the molecular formula C18H15FN4O2 and a molecular weight of 338.3 g/mol. IUPAC name: N-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide. InChIKey: OZHWSOOZCIJFQN-UHFFFAOYSA-N.
| Molecular formula | C18H15FN4O2 |
|---|---|
| Molecular weight | 338.3 g/mol |
| IUPAC name | N-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]-3,4-dihydro-1H-isoquinoline-2-carboxamide |
| InChIKey | OZHWSOOZCIJFQN-UHFFFAOYSA-N |
| SMILES | C1CN(CC2=CC=CC=C21)C(=O)NC3=NN=C(O3)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)