CAS 2163793-44-8 appears in our catalog under these names: MCL-1/BCL-2-IN-2/ 98.03% (existing batch purity), MCL–1/BCL–2–IN–2, Mcl-1/bcl-2-in-2, 2-(2-Aminoethyl)-6-((4-bromophenyl)thio)-1H-benzo[de]isoquinoline-1,3(2H)-dione, 98%, 98%, MCL-1/BCL-2-IN-2, 99.05%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 100 mg.
2-(2-aminoethyl)-6-(4-bromophenyl)sulfanylbenzo[de]isoquinoline-1,3-dione (CAS 2163793-44-8) is a chemical compound with the molecular formula C20H15BrN2O2S and a molecular weight of 427.3 g/mol. IUPAC name: 2-(2-aminoethyl)-6-(4-bromophenyl)sulfanylbenzo[de]isoquinoline-1,3-dione. InChIKey: LPOALFWTLPKKNW-UHFFFAOYSA-N.
| Molecular formula | C20H15BrN2O2S |
|---|---|
| Molecular weight | 427.3 g/mol |
| IUPAC name | 2-(2-aminoethyl)-6-(4-bromophenyl)sulfanylbenzo[de]isoquinoline-1,3-dione |
| InChIKey | LPOALFWTLPKKNW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC3=C2C(=C1)C(=O)N(C3=O)CCN)SC4=CC=C(C=C4)Br |
Computed by PubChem (NCBI)