CAS 91840-27-6 appears in our catalog under these names: MDCG sodium/ 98.47% (existing batch purity), N–methyl–N–dithiocarboxyglucamine sodium, N-(Dithiocarboxy)-N-methyl-D-glucamine sodium salt, N-methyl-N-dithiocarboxyglucamine (sodium), N-methyl-N-dithiocarboxyglucamine (sodium), 99.50%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg, 5 mg.
Sodium N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate (CAS 91840-27-6) is a chemical compound with the molecular formula C8H16NNaO5S2 and a molecular weight of 293.3 g/mol. IUPAC name: sodium N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate. InChIKey: PLQRBFAACWRSKF-LJTMIZJLSA-M.
| Molecular formula | C8H16NNaO5S2 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | sodium N-methyl-N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]carbamodithioate |
| InChIKey | PLQRBFAACWRSKF-LJTMIZJLSA-M |
| SMILES | CN(C[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)C(=S)[S-].[Na+] |
Computed by PubChem (NCBI)