cas: 676371-64-5 — see every product listed under this CAS number, including other names
METHYL 3-([(TERT-BUTOXY)CARBONYL]AMINO)BICYCLO[1.1.1]PENTANE-1-CARBOXYLATE, 95% (CAS 676371-64-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F504063-250MG |
| cas | 676371-64-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 5g | 877.83 Pln | |
| Fluorochem | 10g | 1408.90 Pln | |
| Fluorochem | 25g | 2788.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[1.1.1]pentane-1-carboxylate (CAS 676371-64-5) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[1.1.1]pentane-1-carboxylate. InChIKey: KDOXMPLTEPMVQD-UHFFFAOYSA-N.
| Molecular formula | C12H19NO4 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]bicyclo[1.1.1]pentane-1-carboxylate |
| InChIKey | KDOXMPLTEPMVQD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CC(C1)(C2)C(=O)OC |
Computed by PubChem (NCBI)