cas: 1142234-38-5 — see every product listed under this CAS number, including other names
METHYL 3-(3-HYDROXYPHENYL)BUTANOATE (CAS 1142234-38-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387481-1G |
| cas | 1142234-38-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2950.02 Pln | |
| Fluorochem | 5g | 6766.39 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 3-(3-hydroxyphenyl)butanoate (CAS 1142234-38-5) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: methyl 3-(3-hydroxyphenyl)butanoate. InChIKey: YAGQTKVZMWEMLI-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | methyl 3-(3-hydroxyphenyl)butanoate |
| InChIKey | YAGQTKVZMWEMLI-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)OC)C1=CC(=CC=C1)O |
Computed by PubChem (NCBI)