cas: 2657-67-2 — see every product listed under this CAS number, including other names
MEso-1,2,3,4-tetrabromobutane, 98% (CAS 2657-67-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A751704-5g |
| cas | 2657-67-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 278.32 Pln | |
| AmBeed | 1g | 154.63 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S,3R)-1,2,3,4-tetrabromobutane (CAS 2657-67-2) is a chemical compound with the molecular formula C4H6Br4 and a molecular weight of 373.71 g/mol. IUPAC name: (2S,3R)-1,2,3,4-tetrabromobutane. InChIKey: HGRZLIGHKHRTRE-ZXZARUISSA-N.
| Molecular formula | C4H6Br4 |
|---|---|
| Molecular weight | 373.71 g/mol |
| IUPAC name | (2S,3R)-1,2,3,4-tetrabromobutane |
| InChIKey | HGRZLIGHKHRTRE-ZXZARUISSA-N |
| SMILES | C([C@H]([C@H](CBr)Br)Br)Br |
Computed by PubChem (NCBI)