CAS 2657-67-2 appears in our catalog under these names: Meso-1,2,3,4-tetrabromobutane, 95%, MEso-1,2,3,4-tetrabromobutane, 98%, meso–1,2,3,4–Tetrabromobutane, meso-1,2,3,4-Tetrabromobutane, >98.0%(GC), meso-1,2,3,4-Tetrabromobutane. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 100g, 1g, 5g, 500g.
(2S,3R)-1,2,3,4-tetrabromobutane (CAS 2657-67-2) is a chemical compound with the molecular formula C4H6Br4 and a molecular weight of 373.71 g/mol. IUPAC name: (2S,3R)-1,2,3,4-tetrabromobutane. InChIKey: HGRZLIGHKHRTRE-ZXZARUISSA-N.
| Molecular formula | C4H6Br4 |
|---|---|
| Molecular weight | 373.71 g/mol |
| IUPAC name | (2S,3R)-1,2,3,4-tetrabromobutane |
| InChIKey | HGRZLIGHKHRTRE-ZXZARUISSA-N |
| SMILES | C([C@H]([C@H](CBr)Br)Br)Br |
Computed by PubChem (NCBI)