cas: 155155-64-9 — see every product listed under this CAS number, including other names
MEthyl (phenyl 5-acetamido-4,7,8,9-tetra-o-acetyl-3,5-dideoxy-2-thio-d-glycero-d-galacto-2-nonulopyranosid)onate, ≥97%, mixture of isomers, ≥97%, mixture of isomers (CAS 155155-64-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112NNE-50mg |
| cas | 155155-64-9 |
| size | 50mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 189.20 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 698.00 Pln |
| purity | ≥97%, mixture of isomers |
|---|---|
| delivery time | 3 weeks |
Methyl (4S,5R,6R)-5-acetamido-4-acetyloxy-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (CAS 155155-64-9) is a chemical compound with the molecular formula C26H33NO12S and a molecular weight of 583.6 g/mol. IUPAC name: methyl (4S,5R,6R)-5-acetamido-4-acetyloxy-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate. InChIKey: NPLKOUSSDBQHEN-MVWXVPEESA-N.
| Molecular formula | C26H33NO12S |
|---|---|
| Molecular weight | 583.6 g/mol |
| IUPAC name | methyl (4S,5R,6R)-5-acetamido-4-acetyloxy-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| InChIKey | NPLKOUSSDBQHEN-MVWXVPEESA-N |
| SMILES | CC(=O)N[C@@H]1[C@H](CC(O[C@H]1[C@@H]([C@@H](COC(=O)C)OC(=O)C)OC(=O)C)(C(=O)OC)SC2=CC=CC=C2)OC(=O)C |
Computed by PubChem (NCBI)