cas: 155155-64-9 — see every product listed under this CAS number, including other names
Phenyl 4,7,8,9-tetra-O-acetyl-2-thio-N-acetyl-D-neuraminic acid methyl ester (CAS 155155-64-9) is a chemical reagent available from Chemat. Available pack sizes: 2000mg, 1000mg, 5000mg, 25000mg, 10000mg, 1g, 2g, 5g. Offered by: Biosynth, Roth.
| brand | Biosynth |
|---|---|
| catalog number | MP08082-2000mg |
| cas | 155155-64-9 |
| size | 2000mg |
| brand | size | price | |
|---|---|---|---|
| Biosynth | 2000mg | price on request | |
| Biosynth | 1000mg | price on request | |
| Biosynth | 5000mg | price on request | |
| Biosynth | 25000mg | price on request | |
| Biosynth | 10000mg | price on request | |
| Roth | 1g | 1439.48 Pln | |
| Roth | 2g | 2241.82 Pln | |
| Roth | 5g | 4648.81 Pln | |
| Roth | 10g | 6791.51 Pln |
| category | Carbohydrates |
|---|---|
| sub-category 1 | Monosaccharides |
| purity | No data |
| delivery time | 1-2 weeks |
Methyl (4S,5R,6R)-5-acetamido-4-acetyloxy-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (CAS 155155-64-9) is a chemical compound with the molecular formula C26H33NO12S and a molecular weight of 583.6 g/mol. IUPAC name: methyl (4S,5R,6R)-5-acetamido-4-acetyloxy-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate. InChIKey: NPLKOUSSDBQHEN-MVWXVPEESA-N.
| Molecular formula | C26H33NO12S |
|---|---|
| Molecular weight | 583.6 g/mol |
| IUPAC name | methyl (4S,5R,6R)-5-acetamido-4-acetyloxy-2-phenylsulfanyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| InChIKey | NPLKOUSSDBQHEN-MVWXVPEESA-N |
| SMILES | CC(=O)N[C@@H]1[C@H](CC(O[C@H]1[C@@H]([C@@H](COC(=O)C)OC(=O)C)OC(=O)C)(C(=O)OC)SC2=CC=CC=C2)OC(=O)C |
Computed by PubChem (NCBI)