CAS 1146188-19-3 appears in our catalog under these names: MIPS521/ 99.88% (existing batch purity), MIPS521, (2-Amino-4-(3,5-bis(trifluoromethyl)phenyl)thiophen-3-yl)(4-chlorophenyl)methanone, 97%, 97%, MIPS521, 98.21%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
[2-amino-4-[3,5-bis(trifluoromethyl)phenyl]thiophen-3-yl]-(4-chlorophenyl)methanone (CAS 1146188-19-3) is a chemical compound with the molecular formula C19H10ClF6NOS and a molecular weight of 449.8 g/mol. IUPAC name: [2-amino-4-[3,5-bis(trifluoromethyl)phenyl]thiophen-3-yl]-(4-chlorophenyl)methanone. InChIKey: IVHJBJJHYFIUOA-UHFFFAOYSA-N.
| Molecular formula | C19H10ClF6NOS |
|---|---|
| Molecular weight | 449.8 g/mol |
| IUPAC name | [2-amino-4-[3,5-bis(trifluoromethyl)phenyl]thiophen-3-yl]-(4-chlorophenyl)methanone |
| InChIKey | IVHJBJJHYFIUOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(SC=C2C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)N)Cl |
Computed by PubChem (NCBI)