Products 1956368-39-0
CAS 1956368-39-0 appears in our catalog under these names: MJN68390/ 99.06% (existing batch purity), CASP8–IN–1, MJN68390, CASP8-IN-1, 98.97%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
2-chloro-N-[(3R)-1-(4-morpholin-4-ylbenzoyl)piperidin-3-yl]-N-phenylacetamide (CAS 1956368-39-0) is a chemical compound with the molecular formula C24H28ClN3O3 and a molecular weight of 441.9 g/mol. IUPAC name: 2-chloro-N-[(3R)-1-(4-morpholin-4-ylbenzoyl)piperidin-3-yl]-N-phenylacetamide. InChIKey: MRAMUVZVDBOPEH-JOCHJYFZSA-N.
| Molecular formula | C24H28ClN3O3 |
|---|---|
| Molecular weight | 441.9 g/mol |
| IUPAC name | 2-chloro-N-[(3R)-1-(4-morpholin-4-ylbenzoyl)piperidin-3-yl]-N-phenylacetamide |
| InChIKey | MRAMUVZVDBOPEH-JOCHJYFZSA-N |
| SMILES | C1C[C@H](CN(C1)C(=O)C2=CC=C(C=C2)N3CCOCC3)N(C4=CC=CC=C4)C(=O)CCl |
Computed by PubChem (NCBI)