cas: 443642-29-3 — see every product listed under this CAS number, including other names
MK-0608 95% (CAS 443642-29-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A244674-1mg |
| cas | 443642-29-3 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 264.69 Pln | |
| Ambeed | 5mg | 487.19 Pln | |
| Ambeed | 10mg | 693.00 Pln | |
| Ambeed | 25mg | 1316.00 Pln | |
| Ambeed | 50mg | 1933.44 Pln | |
| Ambeed | 100mg | 2867.94 Pln | |
| Ambeed | 250mg | 4820.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A244674 |
(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (CAS 443642-29-3) is a chemical compound with the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. IUPAC name: (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol. InChIKey: IRZRJANZDIOOIF-GAJNKVMBSA-N.
| Molecular formula | C12H16N4O4 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| InChIKey | IRZRJANZDIOOIF-GAJNKVMBSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=CC3=C(N=CN=C32)N)CO)O)O |
Computed by PubChem (NCBI)