CAS 443642-29-3 appears in our catalog under these names: 7-Deaza-2'-C-methyladenosine, 50 mg, 7-Deaza-2'-C-methyladenosine, MK–0608, MK-0608/ 99.42% (existing batch purity), MK-0608 95%. Offered by: Roth, TRC, GLPBio, TargetMol, Biosynth. Available pack sizes: 50mg, 1g, 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 2mg, 25mg.
(2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (CAS 443642-29-3) is a chemical compound with the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. IUPAC name: (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol. InChIKey: IRZRJANZDIOOIF-GAJNKVMBSA-N.
| Molecular formula | C12H16N4O4 |
|---|---|
| Molecular weight | 280.28 g/mol |
| IUPAC name | (2R,3R,4R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| InChIKey | IRZRJANZDIOOIF-GAJNKVMBSA-N |
| SMILES | C[C@]1([C@@H]([C@H](O[C@H]1N2C=CC3=C(N=CN=C32)N)CO)O)O |
Computed by PubChem (NCBI)