cas: 1032350-13-2 — see every product listed under this CAS number, including other names
MK-2206 2HCl 98% (CAS 1032350-13-2) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 5g, 1mg, 10mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A145592-5mg |
| cas | 1032350-13-2 |
| size | 5mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 220.19 Pln | |
| Ambeed | 5g | 14799.50 Pln | |
| Ambeed | 1mg | 175.69 Pln | |
| Ambeed | 10mg | 314.75 Pln | |
| Ambeed | 100mg | 1010.06 Pln | |
| Ambeed | 250mg | 1672.00 Pln | |
| Ambeed | 1g | 3752.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A145592 |
8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl-2H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-3-one;dihydrochloride (CAS 1032350-13-2) is a chemical compound with the molecular formula C25H23Cl2N5O and a molecular weight of 480.4 g/mol. IUPAC name: 8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl-2H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-3-one;dihydrochloride. InChIKey: HWUHTJIKQZZBRA-UHFFFAOYSA-N.
| Molecular formula | C25H23Cl2N5O |
|---|---|
| Molecular weight | 480.4 g/mol |
| IUPAC name | 8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl-2H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-3-one;dihydrochloride |
| InChIKey | HWUHTJIKQZZBRA-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=C(C=C2)C3=C(C=C4C(=N3)C=CN5C4=NNC5=O)C6=CC=CC=C6)N.Cl.Cl |
Computed by PubChem (NCBI)