CAS 1032350-13-2 appears in our catalog under these names: MK-2206 Dihydrochloride, >95% (HPLC), MK-2206 dihydrochloride/ 99.69% (existing batch purity), MK–2206 dihydrochloride, MK 2206 dihydrochloride, MK-2206 dihydrochloride. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 1mg, 25mg, 50mg, 2mg, 5mg, 10mg, 100mg, 200mg.
8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl-2H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-3-one;dihydrochloride (CAS 1032350-13-2) is a chemical compound with the molecular formula C25H23Cl2N5O and a molecular weight of 480.4 g/mol. IUPAC name: 8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl-2H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-3-one;dihydrochloride. InChIKey: HWUHTJIKQZZBRA-UHFFFAOYSA-N.
| Molecular formula | C25H23Cl2N5O |
|---|---|
| Molecular weight | 480.4 g/mol |
| IUPAC name | 8-[4-(1-aminocyclobutyl)phenyl]-9-phenyl-2H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-3-one;dihydrochloride |
| InChIKey | HWUHTJIKQZZBRA-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC=C(C=C2)C3=C(C=C4C(=N3)C=CN5C4=NNC5=O)C6=CC=CC=C6)N.Cl.Cl |
Computed by PubChem (NCBI)