Products 1093119-54-0
CAS 1093119-54-0 appears in our catalog under these names: MKC3946/ 99.97% (existing batch purity), MKC–3946, MKC-3946, MKC3946 97%, MKC3946, 97%, 97%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg, 10 mg.
2-hydroxy-6-[5-(4-methylpiperazine-1-carbonyl)thiophen-2-yl]naphthalene-1-carbaldehyde (CAS 1093119-54-0) is a chemical compound with the molecular formula C21H20N2O3S and a molecular weight of 380.5 g/mol. IUPAC name: 2-hydroxy-6-[5-(4-methylpiperazine-1-carbonyl)thiophen-2-yl]naphthalene-1-carbaldehyde. InChIKey: IVQVBMWPWPTSNO-UHFFFAOYSA-N.
| Molecular formula | C21H20N2O3S |
|---|---|
| Molecular weight | 380.5 g/mol |
| IUPAC name | 2-hydroxy-6-[5-(4-methylpiperazine-1-carbonyl)thiophen-2-yl]naphthalene-1-carbaldehyde |
| InChIKey | IVQVBMWPWPTSNO-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)C2=CC=C(S2)C3=CC4=C(C=C3)C(=C(C=C4)O)C=O |
Computed by PubChem (NCBI)