CAS 1360705-96-9 appears in our catalog under these names: Ml 210, 97%, ML-210/ 97%, ML–210, ML 210, [4-[Bis(4-chlorophenyl)methyl]piperazin-1-yl]-(5-methyl-4-nitro-1,2-oxazol-3-yl)methanone, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 100mg, 1g, 1mg, 2mg, 5mg, 10mg, 25mg.
[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]-(5-methyl-4-nitro-1,2-oxazol-3-yl)methanone (CAS 1360705-96-9) is a chemical compound with the molecular formula C22H20Cl2N4O4 and a molecular weight of 475.3 g/mol. IUPAC name: [4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]-(5-methyl-4-nitro-1,2-oxazol-3-yl)methanone. InChIKey: VIBHJPDPEVVDTB-UHFFFAOYSA-N.
| Molecular formula | C22H20Cl2N4O4 |
|---|---|
| Molecular weight | 475.3 g/mol |
| IUPAC name | [4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]-(5-methyl-4-nitro-1,2-oxazol-3-yl)methanone |
| InChIKey | VIBHJPDPEVVDTB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C(=O)N2CCN(CC2)C(C3=CC=C(C=C3)Cl)C4=CC=C(C=C4)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)