Products 1638211-04-7
CAS 1638211-04-7 appears in our catalog under these names: ML303/ 99.79% (existing batch purity), ML303, ML303, ≥98%, ≥98%, ML303, 99.62%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 10 mg.
2-methoxy-4-[3-methyl-1-[4-(trifluoromethyl)phenyl]pyrazolo[3,4-b]pyridin-4-yl]phenol (CAS 1638211-04-7) is a chemical compound with the molecular formula C21H16F3N3O2 and a molecular weight of 399.4 g/mol. IUPAC name: 2-methoxy-4-[3-methyl-1-[4-(trifluoromethyl)phenyl]pyrazolo[3,4-b]pyridin-4-yl]phenol. InChIKey: YBRHGNCGFMRGSV-UHFFFAOYSA-N.
| Molecular formula | C21H16F3N3O2 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | 2-methoxy-4-[3-methyl-1-[4-(trifluoromethyl)phenyl]pyrazolo[3,4-b]pyridin-4-yl]phenol |
| InChIKey | YBRHGNCGFMRGSV-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=NC=CC(=C12)C3=CC(=C(C=C3)O)OC)C4=CC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)