CAS 315698-17-0 appears in our catalog under these names: ML311/ 99.75% (existing batch purity), ML-311, ML311, ML311, 98.98%, ML311 (Standard). Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1 mg.
7-[(4-ethylpiperazin-1-yl)-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol (CAS 315698-17-0) is a chemical compound with the molecular formula C23H24F3N3O and a molecular weight of 415.5 g/mol. IUPAC name: 7-[(4-ethylpiperazin-1-yl)-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol. InChIKey: NGAPBLRRJSKIRT-UHFFFAOYSA-N.
| Molecular formula | C23H24F3N3O |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | 7-[(4-ethylpiperazin-1-yl)-[4-(trifluoromethyl)phenyl]methyl]quinolin-8-ol |
| InChIKey | NGAPBLRRJSKIRT-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)C(C2=CC=C(C=C2)C(F)(F)F)C3=C(C4=C(C=CC=N4)C=C3)O |
Computed by PubChem (NCBI)