CAS 1610516-67-0 appears in our catalog under these names: ML318, ML318/ 98.65% (existing batch purity), 2-(4-Fluorophenyl)-2-(6-(trifluoromethyl)pyridin-2-yl)acetonitrile, 98%, 98%, ML318, 99.26%, ML318 (Standard). Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 1mg, 100mg, 10 mg.
2-(4-fluorophenyl)-2-[6-(trifluoromethyl)-2-pyridinyl]acetonitrile (CAS 1610516-67-0) is a chemical compound with the molecular formula C14H8F4N2 and a molecular weight of 280.22 g/mol. IUPAC name: 2-(4-fluorophenyl)-2-[6-(trifluoromethyl)-2-pyridinyl]acetonitrile. InChIKey: DXQNDKQUHKVTTC-UHFFFAOYSA-N.
| Molecular formula | C14H8F4N2 |
|---|---|
| Molecular weight | 280.22 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-2-[6-(trifluoromethyl)-2-pyridinyl]acetonitrile |
| InChIKey | DXQNDKQUHKVTTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)C(F)(F)F)C(C#N)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)