CAS 899713-86-1 appears in our catalog under these names: ML348/ 99.51% (existing batch purity), ML 348, ML348, ML348 99+%, N-(2-Chloro-5-(trifluoromethyl)phenyl)-2-(4-(furan-2-carbonyl)piperazin-1-yl)acetamide, 99+%, 99+%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide (CAS 899713-86-1) is a chemical compound with the molecular formula C18H17ClF3N3O3 and a molecular weight of 415.8 g/mol. IUPAC name: N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide. InChIKey: OXKNHBBDOIMFFQ-UHFFFAOYSA-N.
| Molecular formula | C18H17ClF3N3O3 |
|---|---|
| Molecular weight | 415.8 g/mol |
| IUPAC name | N-[2-chloro-5-(trifluoromethyl)phenyl]-2-[4-(furan-2-carbonyl)piperazin-1-yl]acetamide |
| InChIKey | OXKNHBBDOIMFFQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1CC(=O)NC2=C(C=CC(=C2)C(F)(F)F)Cl)C(=O)C3=CC=CO3 |
Computed by PubChem (NCBI)