CAS 890819-86-0 appears in our catalog under these names: ML349/ 99.59% (existing batch purity), ML 349, ML 349, (5,5-dioxido-4H-thieno[3,2-c]thiochromen-2-yl)(4-(4-methoxyphenyl)piperazin-1-yl)methanone, 99.88% ,, 99.88% ,, ML349, 99.47%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 10 mg.
(5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (CAS 890819-86-0) is a chemical compound with the molecular formula C23H22N2O4S2 and a molecular weight of 454.6 g/mol. IUPAC name: (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone. InChIKey: YVIJPELUPZUEJX-UHFFFAOYSA-N.
| Molecular formula | C23H22N2O4S2 |
|---|---|
| Molecular weight | 454.6 g/mol |
| IUPAC name | (5,5-dioxo-4H-thieno[3,2-c]thiochromen-2-yl)-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| InChIKey | YVIJPELUPZUEJX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2CCN(CC2)C(=O)C3=CC4=C(S3)C5=CC=CC=C5S(=O)(=O)C4 |
Computed by PubChem (NCBI)