Products 1928763-08-9
CAS 1928763-08-9 appears in our catalog under these names: ML418/ 98.1% (existing batch purity), ML 418, ML418, ML418 98%, ML418, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
Propan-2-yl N-[1-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]piperidin-4-yl]carbamate (CAS 1928763-08-9) is a chemical compound with the molecular formula C19H24ClN3O3 and a molecular weight of 377.9 g/mol. IUPAC name: propan-2-yl N-[1-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]piperidin-4-yl]carbamate. InChIKey: CWIXCQOSULUGBT-UHFFFAOYSA-N.
| Molecular formula | C19H24ClN3O3 |
|---|---|
| Molecular weight | 377.9 g/mol |
| IUPAC name | propan-2-yl N-[1-[(5-chloro-8-hydroxyquinolin-7-yl)methyl]piperidin-4-yl]carbamate |
| InChIKey | CWIXCQOSULUGBT-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)NC1CCN(CC1)CC2=CC(=C3C=CC=NC3=C2O)Cl |
Computed by PubChem (NCBI)