CAS 10179-57-4 appears in our catalog under these names: MLS-573151/ 99.64% (existing batch purity), MLS–573151, 4-(3,5-Diphenyl-4,5-dihydro-1H-pyrazol-1-yl)benzenesulfonamide, MLS-573151 99%, MLS-573151, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonamide (CAS 10179-57-4) is a chemical compound with the molecular formula C21H19N3O2S and a molecular weight of 377.5 g/mol. IUPAC name: 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonamide. InChIKey: OPPCVEVPKHRJNY-UHFFFAOYSA-N.
| Molecular formula | C21H19N3O2S |
|---|---|
| Molecular weight | 377.5 g/mol |
| IUPAC name | 4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)benzenesulfonamide |
| InChIKey | OPPCVEVPKHRJNY-UHFFFAOYSA-N |
| SMILES | C1C(N(N=C1C2=CC=CC=C2)C3=CC=C(C=C3)S(=O)(=O)N)C4=CC=CC=C4 |
Computed by PubChem (NCBI)