CAS 159187-70-9 appears in our catalog under these names: MM 77 dihydrochloride/ 100%, MM 77 dihydrochloride, Mm 77 dihydrochloride, MM 77 2HCl, ≥98%, ≥98%, MM 77 (dihydrochloride). Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]pyrrolidine-2,5-dione;dihydrochloride (CAS 159187-70-9) is a chemical compound with the molecular formula C19H29Cl2N3O3 and a molecular weight of 418.4 g/mol. IUPAC name: 1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]pyrrolidine-2,5-dione;dihydrochloride. InChIKey: ZYCVVOZXHNDRCO-UHFFFAOYSA-N.
| Molecular formula | C19H29Cl2N3O3 |
|---|---|
| Molecular weight | 418.4 g/mol |
| IUPAC name | 1-[4-[4-(2-methoxyphenyl)piperazin-1-yl]butyl]pyrrolidine-2,5-dione;dihydrochloride |
| InChIKey | ZYCVVOZXHNDRCO-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N2CCN(CC2)CCCCN3C(=O)CCC3=O.Cl.Cl |
Computed by PubChem (NCBI)